C11H15FN2 — CID 121219593
N'-(3-fluorophenyl)-3-methylbutanimidamide (PubChem CID 121219593) has the molecular formula C11H15FN2 and a molecular weight of 194.25 g/mol. Its IUPAC name is N'-(3-fluorophenyl)-3-methylbutanimidamide.
| Compound Name | N'-(3-fluorophenyl)-3-methylbutanimidamide |
|---|---|
| PubChem CID | 121219593 |
| Molecular Formula | C11H15FN2 |
| Molecular Weight | 194.25 g/mol |
| Exact Mass | 194.12 |
| IUPAC Name | N'-(3-fluorophenyl)-3-methylbutanimidamide |
| SMILES | CC(C)C/C(N)=N\c1cccc(F)c1 |
| InChI | InChI=1S/C11H15FN2/c1-8(2)6-11(13)14-10-5-3-4-9(12)7-10/h3-5,7-8H,6H2,1-2H3,(H2,13,14) |
| InChIKey | LLYHUWIIMFVBSW-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.25 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|