C9H8F3N — CID 130247360
1,1-difluoro-N-(3-fluorophenyl)propan-2-imine (PubChem CID 130247360) has the molecular formula C9H8F3N and a molecular weight of 187.16 g/mol. Its IUPAC name is 1,1-difluoro-N-(3-fluorophenyl)propan-2-imine.
| Compound Name | 1,1-difluoro-N-(3-fluorophenyl)propan-2-imine |
|---|---|
| PubChem CID | 130247360 |
| Molecular Formula | C9H8F3N |
| Molecular Weight | 187.16 g/mol |
| Exact Mass | 187.06 |
| IUPAC Name | 1,1-difluoro-N-(3-fluorophenyl)propan-2-imine |
| SMILES | C/C(=N\c1cccc(F)c1)C(F)F |
| InChI | InChI=1S/C9H8F3N/c1-6(9(11)12)13-8-4-2-3-7(10)5-8/h2-5,9H,1H3/b13-6+ |
| InChIKey | QCQTTYFHPXSDBB-AWNIVKPZSA-N |
| XLogP | 3.18 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.16 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|