C14H12F2N2 — CID 166445658
(4-fluoro-2,6-dimethylphenyl)-(3-fluorophenyl)diazene (PubChem CID 166445658) has the molecular formula C14H12F2N2 and a molecular weight of 246.26 g/mol. Its IUPAC name is (4-fluoro-2,6-dimethylphenyl)-(3-fluorophenyl)diazene.
| Compound Name | (4-fluoro-2,6-dimethylphenyl)-(3-fluorophenyl)diazene |
|---|---|
| PubChem CID | 166445658 |
| Molecular Formula | C14H12F2N2 |
| Molecular Weight | 246.26 g/mol |
| Exact Mass | 246.10 |
| IUPAC Name | (4-fluoro-2,6-dimethylphenyl)-(3-fluorophenyl)diazene |
| SMILES | Cc1cc(F)cc(C)c1/N=N/c1cccc(F)c1 |
| InChI | InChI=1S/C14H12F2N2/c1-9-6-12(16)7-10(2)14(9)18-17-13-5-3-4-11(15)8-13/h3-8H,1-2H3/b18-17+ |
| InChIKey | JLWWBMUPSNKHFT-ISLYRVAYSA-N |
| XLogP | 5.00 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.26 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|