C16H19N3 — CID 102503895
4-[(2,6-dimethylphenyl)diazenyl]-3,5-dimethylaniline (PubChem CID 102503895) has the molecular formula C16H19N3 and a molecular weight of 253.35 g/mol. Its IUPAC name is 4-[(2,6-dimethylphenyl)diazenyl]-3,5-dimethylaniline.
| Compound Name | 4-[(2,6-dimethylphenyl)diazenyl]-3,5-dimethylaniline |
|---|---|
| PubChem CID | 102503895 |
| Molecular Formula | C16H19N3 |
| Molecular Weight | 253.35 g/mol |
| Exact Mass | 253.16 |
| IUPAC Name | 4-[(2,6-dimethylphenyl)diazenyl]-3,5-dimethylaniline |
| SMILES | Cc1cccc(C)c1/N=N/c1c(C)cc(N)cc1C |
| InChI | InChI=1S/C16H19N3/c1-10-6-5-7-11(2)15(10)18-19-16-12(3)8-14(17)9-13(16)4/h5-9H,17H2,1-4H3/b19-18+ |
| InChIKey | PWYBBIJEVYCLEO-VHEBQXMUSA-N |
| XLogP | 4.92 |
| TPSA | 50.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.35 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|