C21H24N2S2 — CID 20582762
2-N-(2,6-dimethylphenyl)-3-N-(2,4,6-trimethylphenyl)-1,4-dithiane-2,3-diimine (PubChem CID 20582762) has the molecular formula C21H24N2S2 and a molecular weight of 368.57 g/mol. Its IUPAC name is 2-N-(2,6-dimethylphenyl)-3-N-(2,4,6-trimethylphenyl)-1,4-dithiane-2,3-diimine.
| Compound Name | 2-N-(2,6-dimethylphenyl)-3-N-(2,4,6-trimethylphenyl)-1,4-dithiane-2,3-diimine |
|---|---|
| PubChem CID | 20582762 |
| Molecular Formula | C21H24N2S2 |
| Molecular Weight | 368.57 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | 2-N-(2,6-dimethylphenyl)-3-N-(2,4,6-trimethylphenyl)-1,4-dithiane-2,3-diimine |
| SMILES | Cc1cc(C)c(/N=C2\SCCS\C2=N/c2c(C)cccc2C)c(C)c1 |
| InChI | InChI=1S/C21H24N2S2/c1-13-11-16(4)19(17(5)12-13)23-21-20(24-9-10-25-21)22-18-14(2)7-6-8-15(18)3/h6-8,11-12H,9-10H2,1-5H3/b22-20-,23-21- |
| InChIKey | WHHLIQUDEDSAAB-YEUCEMRASA-N |
| XLogP | 6.47 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.57 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|