C31H31BrN2Ni- — CID 20789300
1-N,2-N-bis(2,4,6-trimethylphenyl)acenaphthylene-1,2-diimine;bromonickel;carbanide (PubChem CID 20789300) has the molecular formula C31H31BrN2Ni- and a molecular weight of 570.20 g/mol. Its IUPAC name is 1-N,2-N-bis(2,4,6-trimethylphenyl)acenaphthylene-1,2-diimine;bromonickel;carbanide.
| Compound Name | 1-N,2-N-bis(2,4,6-trimethylphenyl)acenaphthylene-1,2-diimine;bromonickel;carbanide |
|---|---|
| PubChem CID | 20789300 |
| Molecular Formula | C31H31BrN2Ni- |
| Molecular Weight | 570.20 g/mol |
| Exact Mass | 568.10 |
| IUPAC Name | 1-N,2-N-bis(2,4,6-trimethylphenyl)acenaphthylene-1,2-diimine;bromonickel;carbanide |
| SMILES | Cc1cc(C)c(/N=C2C(=N/c3c(C)cc(C)cc3C)/c3cccc4cccc/2c34)c(C)c1.[CH3-].[Ni]Br |
| InChI | InChI=1S/C30H28N2.CH3.BrH.Ni/c1-17-13-19(3)27(20(4)14-17)31-29-24-11-7-9-23-10-8-12-25(26(23)24)30(29)32-28-21(5)15-18(2)16-22(28)6;;;/h7-16H,1-6H3;1H3;1H;/q;-1;;+1/p-1/b31-29+,32-30+;;; |
| InChIKey | HQIXFTBFLKYMMB-NFSZIFMVSA-M |
| XLogP | 9.24 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.20 |
| LogP ≤ 5 | 9.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|