C36H40N2 — CID 20789308
1-N,2-N-bis(4-tert-butyl-2,6-dimethylphenyl)acenaphthylene-1,2-diimine (PubChem CID 20789308) has the molecular formula C36H40N2 and a molecular weight of 500.73 g/mol. Its IUPAC name is 1-N,2-N-bis(4-tert-butyl-2,6-dimethylphenyl)acenaphthylene-1,2-diimine.
| Compound Name | 1-N,2-N-bis(4-tert-butyl-2,6-dimethylphenyl)acenaphthylene-1,2-diimine |
|---|---|
| PubChem CID | 20789308 |
| Molecular Formula | C36H40N2 |
| Molecular Weight | 500.73 g/mol |
| Exact Mass | 500.32 |
| IUPAC Name | 1-N,2-N-bis(4-tert-butyl-2,6-dimethylphenyl)acenaphthylene-1,2-diimine |
| SMILES | Cc1cc(C(C)(C)C)cc(C)c1/N=C1C(=N/c2c(C)cc(C(C)(C)C)cc2C)/c2cccc3cccc/1c23 |
| InChI | InChI=1S/C36H40N2/c1-21-17-26(35(5,6)7)18-22(2)31(21)37-33-28-15-11-13-25-14-12-16-29(30(25)28)34(33)38-32-23(3)19-27(20-24(32)4)36(8,9)10/h11-20H,1-10H3/b37-33+,38-34+ |
| InChIKey | MIFTYDWWFOJPDT-YEQLPCBTSA-N |
| XLogP | 9.92 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.73 |
| LogP ≤ 5 | 9.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|