C28H18F6N2 — CID 102526185
1-N-[3,5-bis(trifluoromethyl)phenyl]-2-N-(2,6-dimethylphenyl)acenaphthylene-1,2-diimine (PubChem CID 102526185) has the molecular formula C28H18F6N2 and a molecular weight of 496.45 g/mol. Its IUPAC name is 1-N-[3,5-bis(trifluoromethyl)phenyl]-2-N-(2,6-dimethylphenyl)acenaphthylene-1,2-diimine.
| Compound Name | 1-N-[3,5-bis(trifluoromethyl)phenyl]-2-N-(2,6-dimethylphenyl)acenaphthylene-1,2-diimine |
|---|---|
| PubChem CID | 102526185 |
| Molecular Formula | C28H18F6N2 |
| Molecular Weight | 496.45 g/mol |
| Exact Mass | 496.14 |
| IUPAC Name | 1-N-[3,5-bis(trifluoromethyl)phenyl]-2-N-(2,6-dimethylphenyl)acenaphthylene-1,2-diimine |
| SMILES | Cc1cccc(C)c1/N=C1C(=N/c2cc(C(F)(F)F)cc(C(F)(F)F)c2)/c2cccc3cccc/1c23 |
| InChI | InChI=1S/C28H18F6N2/c1-15-6-3-7-16(2)24(15)36-26-22-11-5-9-17-8-4-10-21(23(17)22)25(26)35-20-13-18(27(29,30)31)12-19(14-20)28(32,33)34/h3-14H,1-2H3/b35-25+,36-26+ |
| InChIKey | BHEPHQGUSWMSMU-DKKRNIPZSA-N |
| XLogP | 8.75 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.45 |
| LogP ≤ 5 | 8.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|