C31H27F3N2 — CID 90086005
2-N-[2,6-di(propan-2-yl)phenyl]-1-N-[4-(trifluoromethyl)phenyl]acenaphthylene-1,2-diimine (PubChem CID 90086005) has the molecular formula C31H27F3N2 and a molecular weight of 484.57 g/mol. Its IUPAC name is 2-N-[2,6-di(propan-2-yl)phenyl]-1-N-[4-(trifluoromethyl)phenyl]acenaphthylene-1,2-diimine.
| Compound Name | 2-N-[2,6-di(propan-2-yl)phenyl]-1-N-[4-(trifluoromethyl)phenyl]acenaphthylene-1,2-diimine |
|---|---|
| PubChem CID | 90086005 |
| Molecular Formula | C31H27F3N2 |
| Molecular Weight | 484.57 g/mol |
| Exact Mass | 484.21 |
| IUPAC Name | 2-N-[2,6-di(propan-2-yl)phenyl]-1-N-[4-(trifluoromethyl)phenyl]acenaphthylene-1,2-diimine |
| SMILES | CC(C)c1cccc(C(C)C)c1/N=C1C(=N/c2ccc(C(F)(F)F)cc2)/c2cccc3cccc/1c23 |
| InChI | InChI=1S/C31H27F3N2/c1-18(2)23-10-7-11-24(19(3)4)28(23)36-30-26-13-6-9-20-8-5-12-25(27(20)26)29(30)35-22-16-14-21(15-17-22)31(32,33)34/h5-19H,1-4H3/b35-29+,36-30+ |
| InChIKey | DDKGPLXZOUMMLC-ZRBLUKEISA-N |
| XLogP | 9.36 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.57 |
| LogP ≤ 5 | 9.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|