C31H31Cl2FeN3 — CID 58722039
dichloroiron;2-N-[2,6-di(propan-2-yl)phenyl]-1-N-(2-pyridin-2-ylethyl)acenaphthylene-1,2-diimine (PubChem CID 58722039) has the molecular formula C31H31Cl2FeN3 and a molecular weight of 572.36 g/mol. Its IUPAC name is dichloroiron;2-N-[2,6-di(propan-2-yl)phenyl]-1-N-(2-pyridin-2-ylethyl)acenaphthylene-1,2-diimine.
| Compound Name | dichloroiron;2-N-[2,6-di(propan-2-yl)phenyl]-1-N-(2-pyridin-2-ylethyl)acenaphthylene-1,2-diimine |
|---|---|
| PubChem CID | 58722039 |
| Molecular Formula | C31H31Cl2FeN3 |
| Molecular Weight | 572.36 g/mol |
| Exact Mass | 571.12 |
| IUPAC Name | dichloroiron;2-N-[2,6-di(propan-2-yl)phenyl]-1-N-(2-pyridin-2-ylethyl)acenaphthylene-1,2-diimine |
| SMILES | CC(C)c1cccc(C(C)C)c1/N=C1C(=N/CCc2ccccn2)/c2cccc3cccc/1c23.Cl[Fe]Cl |
| InChI | InChI=1S/C31H31N3.2ClH.Fe/c1-20(2)24-13-9-14-25(21(3)4)29(24)34-31-27-16-8-11-22-10-7-15-26(28(22)27)30(31)33-19-17-23-12-5-6-18-32-23;;;/h5-16,18,20-21H,17,19H2,1-4H3;2*1H;/q;;;+2/p-2/b33-30+,34-31+;;; |
| InChIKey | VXKXTWZVLXUQEK-MPPPEIJASA-L |
| XLogP | 9.02 |
| TPSA | 37.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.36 |
| LogP ≤ 5 | 9.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|