C35H47N3 — CID 59434234
2-N,4-N-bis[2,6-di(propan-2-yl)phenyl]-3-(pyridin-2-ylmethyl)pentane-2,4-diimine (PubChem CID 59434234) has the molecular formula C35H47N3 and a molecular weight of 509.78 g/mol. Its IUPAC name is 2-N,4-N-bis[2,6-di(propan-2-yl)phenyl]-3-(pyridin-2-ylmethyl)pentane-2,4-diimine.
| Compound Name | 2-N,4-N-bis[2,6-di(propan-2-yl)phenyl]-3-(pyridin-2-ylmethyl)pentane-2,4-diimine |
|---|---|
| PubChem CID | 59434234 |
| Molecular Formula | C35H47N3 |
| Molecular Weight | 509.78 g/mol |
| Exact Mass | 509.38 |
| IUPAC Name | 2-N,4-N-bis[2,6-di(propan-2-yl)phenyl]-3-(pyridin-2-ylmethyl)pentane-2,4-diimine |
| SMILES | C/C(=N\c1c(C(C)C)cccc1C(C)C)C(Cc1ccccn1)/C(C)=N/c1c(C(C)C)cccc1C(C)C |
| InChI | InChI=1S/C35H47N3/c1-22(2)29-16-13-17-30(23(3)4)34(29)37-26(9)33(21-28-15-11-12-20-36-28)27(10)38-35-31(24(5)6)18-14-19-32(35)25(7)8/h11-20,22-25,33H,21H2,1-10H3/b37-26+,38-27+ |
| InChIKey | MWXHNGJPBVDMAR-YFLNSSJQSA-N |
| XLogP | 10.32 |
| TPSA | 37.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.78 |
| LogP ≤ 5 | 10.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|