C37H23BF15N2- — CID 177420335
[2-[2,6-di(propan-2-yl)phenyl]imino-2-pyridin-2-ylethyl]-tris(2,3,4,5,6-pentafluorophenyl)boranuide (PubChem CID 177420335) has the molecular formula C37H23BF15N2- and a molecular weight of 791.39 g/mol. Its IUPAC name is [2-[2,6-di(propan-2-yl)phenyl]imino-2-pyridin-2-ylethyl]-tris(2,3,4,5,6-pentafluorophenyl)boranuide.
| Compound Name | [2-[2,6-di(propan-2-yl)phenyl]imino-2-pyridin-2-ylethyl]-tris(2,3,4,5,6-pentafluorophenyl)boranuide |
|---|---|
| PubChem CID | 177420335 |
| Molecular Formula | C37H23BF15N2- |
| Molecular Weight | 791.39 g/mol |
| Exact Mass | 791.17 |
| IUPAC Name | [2-[2,6-di(propan-2-yl)phenyl]imino-2-pyridin-2-ylethyl]-tris(2,3,4,5,6-pentafluorophenyl)boranuide |
| SMILES | CC(C)c1cccc(C(C)C)c1/N=C(/C[B-](c1c(F)c(F)c(F)c(F)c1F)(c1c(F)c(F)c(F)c(F)c1F)c1c(F)c(F)c(F)c(F)c1F)c1ccccn1 |
| InChI | InChI=1S/C37H23BF15N2/c1-13(2)15-8-7-9-16(14(3)4)37(15)55-18(17-10-5-6-11-54-17)12-38(19-22(39)28(45)34(51)29(46)23(19)40,20-24(41)30(47)35(52)31(48)25(20)42)21-26(43)32(49)36(53)33(50)27(21)44/h5-11,13-14H,12H2,1-4H3/q-1/b55-18- |
| InChIKey | MKEOYXLYVZRZFU-VSFBDNSHSA-N |
| XLogP | 9.71 |
| TPSA | 25.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 791.39 |
| LogP ≤ 5 | 9.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|