C23H24N2 — CID 142056339
N-(2-ethyl-6-propan-2-ylphenyl)-1-phenyl-1-pyridin-2-ylmethanimine (PubChem CID 142056339) has the molecular formula C23H24N2 and a molecular weight of 328.46 g/mol. Its IUPAC name is N-(2-ethyl-6-propan-2-ylphenyl)-1-phenyl-1-pyridin-2-ylmethanimine.
| Compound Name | N-(2-ethyl-6-propan-2-ylphenyl)-1-phenyl-1-pyridin-2-ylmethanimine |
|---|---|
| PubChem CID | 142056339 |
| Molecular Formula | C23H24N2 |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.19 |
| IUPAC Name | N-(2-ethyl-6-propan-2-ylphenyl)-1-phenyl-1-pyridin-2-ylmethanimine |
| SMILES | CCc1cccc(C(C)C)c1/N=C(\c1ccccc1)c1ccccn1 |
| InChI | InChI=1S/C23H24N2/c1-4-18-13-10-14-20(17(2)3)22(18)25-23(19-11-6-5-7-12-19)21-15-8-9-16-24-21/h5-17H,4H2,1-3H3/b25-23+ |
| InChIKey | WKDASIHQCJFBOB-WJTDDFOZSA-N |
| XLogP | 5.94 |
| TPSA | 25.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|