C25H26BrN — CID 58238566
1-(3-bromophenyl)-N-[2,6-di(propan-2-yl)phenyl]-1-phenylmethanimine (PubChem CID 58238566) has the molecular formula C25H26BrN and a molecular weight of 420.39 g/mol. Its IUPAC name is 1-(3-bromophenyl)-N-[2,6-di(propan-2-yl)phenyl]-1-phenylmethanimine.
| Compound Name | 1-(3-bromophenyl)-N-[2,6-di(propan-2-yl)phenyl]-1-phenylmethanimine |
|---|---|
| PubChem CID | 58238566 |
| Molecular Formula | C25H26BrN |
| Molecular Weight | 420.39 g/mol |
| Exact Mass | 419.12 |
| IUPAC Name | 1-(3-bromophenyl)-N-[2,6-di(propan-2-yl)phenyl]-1-phenylmethanimine |
| SMILES | CC(C)c1cccc(C(C)C)c1/N=C(\c1ccccc1)c1cccc(Br)c1 |
| InChI | InChI=1S/C25H26BrN/c1-17(2)22-14-9-15-23(18(3)4)25(22)27-24(19-10-6-5-7-11-19)20-12-8-13-21(26)16-20/h5-18H,1-4H3/b27-24+ |
| InChIKey | FFGARFPFMVDITE-SOYKGTTHSA-N |
| XLogP | 7.86 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.39 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|