C17H20N2Ni+2 — CID 158562372
N-(2,6-diethylphenyl)-1-pyridin-2-ylethanimine;nickel(2+) (PubChem CID 158562372) has the molecular formula C17H20N2Ni+2 and a molecular weight of 311.05 g/mol. Its IUPAC name is N-(2,6-diethylphenyl)-1-pyridin-2-ylethanimine;nickel(2+).
| Compound Name | N-(2,6-diethylphenyl)-1-pyridin-2-ylethanimine;nickel(2+) |
|---|---|
| PubChem CID | 158562372 |
| Molecular Formula | C17H20N2Ni+2 |
| Molecular Weight | 311.05 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | N-(2,6-diethylphenyl)-1-pyridin-2-ylethanimine;nickel(2+) |
| SMILES | CCc1cccc(CC)c1/N=C(\C)c1ccccn1.[Ni+2] |
| InChI | InChI=1S/C17H20N2.Ni/c1-4-14-9-8-10-15(5-2)17(14)19-13(3)16-11-6-7-12-18-16;/h6-12H,4-5H2,1-3H3;/q;+2/b19-13+; |
| InChIKey | HRAUHUAUOLBECZ-XTWSRORZSA-N |
| XLogP | 4.34 |
| TPSA | 25.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.05 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|