About palladium(2+);bis(2-(1-pyridin-2-ylethylideneamino)benzenethiolate)
palladium(2+);bis(2-(1-pyridin-2-ylethylideneamino)benzenethiolate) (PubChem CID 10650522) has the molecular formula C26H22N4PdS2
and a molecular weight of 561.04 g/mol. Its IUPAC name is palladium(2+);bis(2-(1-pyridin-2-ylethylideneamino)benzenethiolate).
Molecular Properties
| Compound Name | palladium(2+);bis(2-(1-pyridin-2-ylethylideneamino)benzenethiolate) |
| PubChem CID | 10650522 |
| Molecular Formula | C26H22N4PdS2 |
| Molecular Weight | 561.04 g/mol |
| Exact Mass | 560.03 |
| IUPAC Name | palladium(2+);bis(2-(1-pyridin-2-ylethylideneamino)benzenethiolate) |
| SMILES | C/C(=N\c1ccccc1[S-])c1ccccn1.C/C(=N\c1ccccc1[S-])c1ccccn1.[Pd+2] |
| InChI | InChI=1S/2C13H12N2S.Pd/c2*1-10(11-6-4-5-9-14-11)15-12-7-2-3-8-13(12)16;/h2*2-9,16H,1H3;/q;;+2/p-2/b2*15-10+; |
| InChIKey | TYVXZJIDOMJFOE-ZQSWXEMLSA-L |
| XLogP | 6.25 |
| TPSA | 50.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 561.04 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze palladium(2+);bis(2-(1-pyridin-2-ylethylideneamino)benzenethiolate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of palladium(2+);bis(2-(1-pyridin-2-ylethylideneamino)benzenethiolate)?
The IUPAC name of palladium(2+);bis(2-(1-pyridin-2-ylethylideneamino)benzenethiolate) (CID 10650522) is palladium(2+);bis(2-(1-pyridin-2-ylethylideneamino)benzenethiolate).
What is the SMILES notation for palladium(2+);bis(2-(1-pyridin-2-ylethylideneamino)benzenethiolate)?
The canonical SMILES for palladium(2+);bis(2-(1-pyridin-2-ylethylideneamino)benzenethiolate) is C/C(=N\c1ccccc1[S-])c1ccccn1.C/C(=N\c1ccccc1[S-])c1ccccn1.[Pd+2].
What is the InChIKey of palladium(2+);bis(2-(1-pyridin-2-ylethylideneamino)benzenethiolate)?
The InChIKey is TYVXZJIDOMJFOE-ZQSWXEMLSA-L. The full InChI is InChI=1S/2C13H12N2S.Pd/c2*1-10(11-6-4-5-9-14-11)15-12-7-2-3-8-13(12)16;/h2*2-9,16H,1H3;/q;;+2/p-2/b2*15-10+;.
What are the key properties of palladium(2+);bis(2-(1-pyridin-2-ylethylideneamino)benzenethiolate)?
palladium(2+);bis(2-(1-pyridin-2-ylethylideneamino)benzenethiolate) has a molecular weight of 561.04 g/mol, XLogP of 6.25, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for palladium(2+);bis(2-(1-pyridin-2-ylethylideneamino)benzenethiolate) is sourced from PubChem (CID 10650522), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).