C20H24N4 — CID 46193464
1-pyridin-2-yl-N-[(1R,2R)-2-(1-pyridin-2-ylethylideneamino)cyclohexyl]ethanimine (PubChem CID 46193464) has the molecular formula C20H24N4 and a molecular weight of 320.44 g/mol. Its IUPAC name is 1-pyridin-2-yl-N-[(1R,2R)-2-(1-pyridin-2-ylethylideneamino)cyclohexyl]ethanimine.
| Compound Name | 1-pyridin-2-yl-N-[(1R,2R)-2-(1-pyridin-2-ylethylideneamino)cyclohexyl]ethanimine |
|---|---|
| PubChem CID | 46193464 |
| Molecular Formula | C20H24N4 |
| Molecular Weight | 320.44 g/mol |
| Exact Mass | 320.20 |
| IUPAC Name | 1-pyridin-2-yl-N-[(1R,2R)-2-(1-pyridin-2-ylethylideneamino)cyclohexyl]ethanimine |
| SMILES | C/C(=N\[C@@H]1CCCC[C@H]1/N=C(\C)c1ccccn1)c1ccccn1 |
| InChI | InChI=1S/C20H24N4/c1-15(17-9-5-7-13-21-17)23-19-11-3-4-12-20(19)24-16(2)18-10-6-8-14-22-18/h5-10,13-14,19-20H,3-4,11-12H2,1-2H3/b23-15+,24-16+/t19-,20-/m1/s1 |
| InChIKey | VQPCQHIWEFVZQG-XADFGDBWSA-N |
| XLogP | 4.11 |
| TPSA | 50.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.44 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|