C19H24N4 — CID 102087049
N-[2,2-dimethyl-3-(1-pyridin-2-ylethylideneamino)propyl]-1-pyridin-2-ylethanimine (PubChem CID 102087049) has the molecular formula C19H24N4 and a molecular weight of 308.43 g/mol. Its IUPAC name is N-[2,2-dimethyl-3-(1-pyridin-2-ylethylideneamino)propyl]-1-pyridin-2-ylethanimine.
| Compound Name | N-[2,2-dimethyl-3-(1-pyridin-2-ylethylideneamino)propyl]-1-pyridin-2-ylethanimine |
|---|---|
| PubChem CID | 102087049 |
| Molecular Formula | C19H24N4 |
| Molecular Weight | 308.43 g/mol |
| Exact Mass | 308.20 |
| IUPAC Name | N-[2,2-dimethyl-3-(1-pyridin-2-ylethylideneamino)propyl]-1-pyridin-2-ylethanimine |
| SMILES | C/C(=N\CC(C)(C)C/N=C(\C)c1ccccn1)c1ccccn1 |
| InChI | InChI=1S/C19H24N4/c1-15(17-9-5-7-11-20-17)22-13-19(3,4)14-23-16(2)18-10-6-8-12-21-18/h5-12H,13-14H2,1-4H3/b22-15+,23-16+ |
| InChIKey | KLFMIJGYLRCOJY-QAOSGDJLSA-N |
| XLogP | 3.82 |
| TPSA | 50.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.43 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|