About dichlorovanadium;3-(1-pyridin-2-ylethylideneamino)propan-1-ol
dichlorovanadium;3-(1-pyridin-2-ylethylideneamino)propan-1-ol (PubChem CID 59378654) has the molecular formula C10H14Cl2N2OV
and a molecular weight of 300.09 g/mol. Its IUPAC name is dichlorovanadium;3-(1-pyridin-2-ylethylideneamino)propan-1-ol.
Molecular Properties
| Compound Name | dichlorovanadium;3-(1-pyridin-2-ylethylideneamino)propan-1-ol |
| PubChem CID | 59378654 |
| Molecular Formula | C10H14Cl2N2OV |
| Molecular Weight | 300.09 g/mol |
| Exact Mass | 298.99 |
| IUPAC Name | dichlorovanadium;3-(1-pyridin-2-ylethylideneamino)propan-1-ol |
| SMILES | C/C(=N\CCCO)c1ccccn1.Cl[V]Cl |
| InChI | InChI=1S/C10H14N2O.2ClH.V/c1-9(11-7-4-8-13)10-5-2-3-6-12-10;;;/h2-3,5-6,13H,4,7-8H2,1H3;2*1H;/q;;;+2/p-2/b11-9+;;; |
| InChIKey | SFGQNPHXQUJIJW-OOQPXJNPSA-L |
| XLogP | 2.65 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.09 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze dichlorovanadium;3-(1-pyridin-2-ylethylideneamino)propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichlorovanadium;3-(1-pyridin-2-ylethylideneamino)propan-1-ol?
The IUPAC name of dichlorovanadium;3-(1-pyridin-2-ylethylideneamino)propan-1-ol (CID 59378654) is dichlorovanadium;3-(1-pyridin-2-ylethylideneamino)propan-1-ol.
What is the SMILES notation for dichlorovanadium;3-(1-pyridin-2-ylethylideneamino)propan-1-ol?
The canonical SMILES for dichlorovanadium;3-(1-pyridin-2-ylethylideneamino)propan-1-ol is C/C(=N\CCCO)c1ccccn1.Cl[V]Cl.
What is the InChIKey of dichlorovanadium;3-(1-pyridin-2-ylethylideneamino)propan-1-ol?
The InChIKey is SFGQNPHXQUJIJW-OOQPXJNPSA-L. The full InChI is InChI=1S/C10H14N2O.2ClH.V/c1-9(11-7-4-8-13)10-5-2-3-6-12-10;;;/h2-3,5-6,13H,4,7-8H2,1H3;2*1H;/q;;;+2/p-2/b11-9+;;;.
What are the key properties of dichlorovanadium;3-(1-pyridin-2-ylethylideneamino)propan-1-ol?
dichlorovanadium;3-(1-pyridin-2-ylethylideneamino)propan-1-ol has a molecular weight of 300.09 g/mol, XLogP of 2.65, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for dichlorovanadium;3-(1-pyridin-2-ylethylideneamino)propan-1-ol is sourced from PubChem (CID 59378654), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).