C19H25N5 — CID 139178723
3-(1-pyridin-2-ylethylideneamino)-N-[2-(1-pyridin-2-ylethylideneamino)ethyl]propan-1-amine (PubChem CID 139178723) has the molecular formula C19H25N5 and a molecular weight of 323.44 g/mol. Its IUPAC name is 3-(1-pyridin-2-ylethylideneamino)-N-[2-(1-pyridin-2-ylethylideneamino)ethyl]propan-1-amine.
| Compound Name | 3-(1-pyridin-2-ylethylideneamino)-N-[2-(1-pyridin-2-ylethylideneamino)ethyl]propan-1-amine |
|---|---|
| PubChem CID | 139178723 |
| Molecular Formula | C19H25N5 |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.21 |
| IUPAC Name | 3-(1-pyridin-2-ylethylideneamino)-N-[2-(1-pyridin-2-ylethylideneamino)ethyl]propan-1-amine |
| SMILES | C/C(=N\CCCNCC/N=C(\C)c1ccccn1)c1ccccn1 |
| InChI | InChI=1S/C19H25N5/c1-16(18-8-3-5-11-23-18)21-13-7-10-20-14-15-22-17(2)19-9-4-6-12-24-19/h3-6,8-9,11-12,20H,7,10,13-15H2,1-2H3/b21-16+,22-17+ |
| InChIKey | PKCJHUUDMGADMK-LPFJTETCSA-N |
| XLogP | 2.77 |
| TPSA | 62.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|