C31H29N3 — CID 11984252
N-[2,6-di(propan-2-yl)phenyl]-1-(1,10-phenanthrolin-2-yl)-1-phenylmethanimine (PubChem CID 11984252) has the molecular formula C31H29N3 and a molecular weight of 443.59 g/mol. Its IUPAC name is N-[2,6-di(propan-2-yl)phenyl]-1-(1,10-phenanthrolin-2-yl)-1-phenylmethanimine.
| Compound Name | N-[2,6-di(propan-2-yl)phenyl]-1-(1,10-phenanthrolin-2-yl)-1-phenylmethanimine |
|---|---|
| PubChem CID | 11984252 |
| Molecular Formula | C31H29N3 |
| Molecular Weight | 443.59 g/mol |
| Exact Mass | 443.24 |
| IUPAC Name | N-[2,6-di(propan-2-yl)phenyl]-1-(1,10-phenanthrolin-2-yl)-1-phenylmethanimine |
| SMILES | CC(C)c1cccc(C(C)C)c1/N=C(\c1ccccc1)c1ccc2ccc3cccnc3c2n1 |
| InChI | InChI=1S/C31H29N3/c1-20(2)25-13-8-14-26(21(3)4)31(25)34-28(22-10-6-5-7-11-22)27-18-17-24-16-15-23-12-9-19-32-29(23)30(24)33-27/h5-21H,1-4H3/b34-28+ |
| InChIKey | AYPKPCSIBORPQZ-CDSHQWRTSA-N |
| XLogP | 8.20 |
| TPSA | 38.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.59 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|