C24H28N2O — CID 136749054
2-[N-[2,6-di(propan-2-yl)phenyl]-C-ethylcarbonimidoyl]quinolin-8-ol (PubChem CID 136749054) has the molecular formula C24H28N2O and a molecular weight of 360.50 g/mol. Its IUPAC name is 2-[N-[2,6-di(propan-2-yl)phenyl]-C-ethylcarbonimidoyl]quinolin-8-ol.
| Compound Name | 2-[N-[2,6-di(propan-2-yl)phenyl]-C-ethylcarbonimidoyl]quinolin-8-ol |
|---|---|
| PubChem CID | 136749054 |
| Molecular Formula | C24H28N2O |
| Molecular Weight | 360.50 g/mol |
| Exact Mass | 360.22 |
| IUPAC Name | 2-[N-[2,6-di(propan-2-yl)phenyl]-C-ethylcarbonimidoyl]quinolin-8-ol |
| SMILES | CC/C(=N\c1c(C(C)C)cccc1C(C)C)c1ccc2cccc(O)c2n1 |
| InChI | InChI=1S/C24H28N2O/c1-6-20(21-14-13-17-9-7-12-22(27)23(17)26-21)25-24-18(15(2)3)10-8-11-19(24)16(4)5/h7-16,27H,6H2,1-5H3/b25-20+ |
| InChIKey | YZJZZJCJACWDPB-LKUDQCMESA-N |
| XLogP | 6.72 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.50 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|