C34H33N3 — CID 137214882
1-(4,5-diphenyl-1H-imidazol-2-yl)-N-[2,6-di(propan-2-yl)phenyl]-1-phenylmethanimine (PubChem CID 137214882) has the molecular formula C34H33N3 and a molecular weight of 483.66 g/mol. Its IUPAC name is 1-(4,5-diphenyl-1H-imidazol-2-yl)-N-[2,6-di(propan-2-yl)phenyl]-1-phenylmethanimine.
| Compound Name | 1-(4,5-diphenyl-1H-imidazol-2-yl)-N-[2,6-di(propan-2-yl)phenyl]-1-phenylmethanimine |
|---|---|
| PubChem CID | 137214882 |
| Molecular Formula | C34H33N3 |
| Molecular Weight | 483.66 g/mol |
| Exact Mass | 483.27 |
| IUPAC Name | 1-(4,5-diphenyl-1H-imidazol-2-yl)-N-[2,6-di(propan-2-yl)phenyl]-1-phenylmethanimine |
| SMILES | CC(C)c1cccc(C(C)C)c1/N=C(/c1ccccc1)c1nc(-c2ccccc2)c(-c2ccccc2)[nH]1 |
| InChI | InChI=1S/C34H33N3/c1-23(2)28-21-14-22-29(24(3)4)33(28)35-32(27-19-12-7-13-20-27)34-36-30(25-15-8-5-9-16-25)31(37-34)26-17-10-6-11-18-26/h5-24H,1-4H3,(H,36,37)/b35-32- |
| InChIKey | GTJVZMYVGPRVFY-JCUPVDEDSA-N |
| XLogP | 9.16 |
| TPSA | 41.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.66 |
| LogP ≤ 5 | 9.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|