C25H28N2 — CID 58238596
N-[2,6-di(propan-2-yl)phenyl]-1-(3-pyridin-2-ylphenyl)ethanimine (PubChem CID 58238596) has the molecular formula C25H28N2 and a molecular weight of 356.51 g/mol. Its IUPAC name is N-[2,6-di(propan-2-yl)phenyl]-1-(3-pyridin-2-ylphenyl)ethanimine.
| Compound Name | N-[2,6-di(propan-2-yl)phenyl]-1-(3-pyridin-2-ylphenyl)ethanimine |
|---|---|
| PubChem CID | 58238596 |
| Molecular Formula | C25H28N2 |
| Molecular Weight | 356.51 g/mol |
| Exact Mass | 356.23 |
| IUPAC Name | N-[2,6-di(propan-2-yl)phenyl]-1-(3-pyridin-2-ylphenyl)ethanimine |
| SMILES | C/C(=N\c1c(C(C)C)cccc1C(C)C)c1cccc(-c2ccccn2)c1 |
| InChI | InChI=1S/C25H28N2/c1-17(2)22-12-9-13-23(18(3)4)25(22)27-19(5)20-10-8-11-21(16-20)24-14-6-7-15-26-24/h6-18H,1-5H3/b27-19+ |
| InChIKey | CJNYHRQHOPSTHD-ZXVVBBHZSA-N |
| XLogP | 7.14 |
| TPSA | 25.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.51 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|