C34H35CuN2O4 — CID 139118107
copper(1+);N-[2,6-di(propan-2-yl)phenyl]-1-[6-(3-methoxyphenyl)-2-pyridinyl]ethanimine;2-oxo-2-phenylacetate (PubChem CID 139118107) has the molecular formula C34H35CuN2O4 and a molecular weight of 599.21 g/mol. Its IUPAC name is copper(1+);N-[2,6-di(propan-2-yl)phenyl]-1-[6-(3-methoxyphenyl)-2-pyridinyl]ethanimine;2-oxo-2-phenylacetate.
| Compound Name | copper(1+);N-[2,6-di(propan-2-yl)phenyl]-1-[6-(3-methoxyphenyl)-2-pyridinyl]ethanimine;2-oxo-2-phenylacetate |
|---|---|
| PubChem CID | 139118107 |
| Molecular Formula | C34H35CuN2O4 |
| Molecular Weight | 599.21 g/mol |
| Exact Mass | 598.19 |
| IUPAC Name | copper(1+);N-[2,6-di(propan-2-yl)phenyl]-1-[6-(3-methoxyphenyl)-2-pyridinyl]ethanimine;2-oxo-2-phenylacetate |
| SMILES | COc1cccc(-c2cccc(/C(C)=N/c3c(C(C)C)cccc3C(C)C)n2)c1.O=C([O-])C(=O)c1ccccc1.[Cu+] |
| InChI | InChI=1S/C26H30N2O.C8H6O3.Cu/c1-17(2)22-12-8-13-23(18(3)4)26(22)27-19(5)24-14-9-15-25(28-24)20-10-7-11-21(16-20)29-6;9-7(8(10)11)6-4-2-1-3-5-6;/h7-18H,1-6H3;1-5H,(H,10,11);/q;;+1/p-1/b27-19+;; |
| InChIKey | RLDDARQOAPAWBQ-XPFTWYDJSA-M |
| XLogP | 6.76 |
| TPSA | 91.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.21 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|