C43H47N3O2 — CID 122378442
diphenyl 2-N,6-N-bis[2,6-di(propan-2-yl)phenyl]pyridine-2,6-dicarboximidate (PubChem CID 122378442) has the molecular formula C43H47N3O2 and a molecular weight of 637.87 g/mol. Its IUPAC name is diphenyl 2-N,6-N-bis[2,6-di(propan-2-yl)phenyl]pyridine-2,6-dicarboximidate.
| Compound Name | diphenyl 2-N,6-N-bis[2,6-di(propan-2-yl)phenyl]pyridine-2,6-dicarboximidate |
|---|---|
| PubChem CID | 122378442 |
| Molecular Formula | C43H47N3O2 |
| Molecular Weight | 637.87 g/mol |
| Exact Mass | 637.37 |
| IUPAC Name | diphenyl 2-N,6-N-bis[2,6-di(propan-2-yl)phenyl]pyridine-2,6-dicarboximidate |
| SMILES | CC(C)c1cccc(C(C)C)c1/N=C(\Oc1ccccc1)c1cccc(/C(=N/c2c(C(C)C)cccc2C(C)C)Oc2ccccc2)n1 |
| InChI | InChI=1S/C43H47N3O2/c1-28(2)34-22-15-23-35(29(3)4)40(34)45-42(47-32-18-11-9-12-19-32)38-26-17-27-39(44-38)43(48-33-20-13-10-14-21-33)46-41-36(30(5)6)24-16-25-37(41)31(7)8/h9-31H,1-8H3/b45-42-,46-43- |
| InChIKey | KUELHOCHPJFLSQ-OBBHHDKFSA-N |
| XLogP | 11.89 |
| TPSA | 56.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.87 |
| LogP ≤ 5 | 11.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|