C25H30N4O — CID 23737954
3-[2,6-di(propan-2-yl)phenyl]-1,1-bis(pyridin-2-ylmethyl)urea (PubChem CID 23737954) has the molecular formula C25H30N4O and a molecular weight of 402.54 g/mol. Its IUPAC name is 3-[2,6-di(propan-2-yl)phenyl]-1,1-bis(pyridin-2-ylmethyl)urea.
| Compound Name | 3-[2,6-di(propan-2-yl)phenyl]-1,1-bis(pyridin-2-ylmethyl)urea |
|---|---|
| PubChem CID | 23737954 |
| Molecular Formula | C25H30N4O |
| Molecular Weight | 402.54 g/mol |
| Exact Mass | 402.24 |
| IUPAC Name | 3-[2,6-di(propan-2-yl)phenyl]-1,1-bis(pyridin-2-ylmethyl)urea |
| SMILES | CC(C)c1cccc(C(C)C)c1NC(=O)N(Cc1ccccn1)Cc1ccccn1 |
| InChI | InChI=1S/C25H30N4O/c1-18(2)22-12-9-13-23(19(3)4)24(22)28-25(30)29(16-20-10-5-7-14-26-20)17-21-11-6-8-15-27-21/h5-15,18-19H,16-17H2,1-4H3,(H,28,30) |
| InChIKey | DZHWMQPIOIQCQJ-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.54 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |