C26H31N3 — CID 139174144
N-[2,6-di(propan-2-yl)phenyl]-N'-(2-pyridin-2-ylethyl)benzenecarboximidamide (PubChem CID 139174144) has the molecular formula C26H31N3 and a molecular weight of 385.56 g/mol. Its IUPAC name is N-[2,6-di(propan-2-yl)phenyl]-N'-(2-pyridin-2-ylethyl)benzenecarboximidamide.
| Compound Name | N-[2,6-di(propan-2-yl)phenyl]-N'-(2-pyridin-2-ylethyl)benzenecarboximidamide |
|---|---|
| PubChem CID | 139174144 |
| Molecular Formula | C26H31N3 |
| Molecular Weight | 385.56 g/mol |
| Exact Mass | 385.25 |
| IUPAC Name | N-[2,6-di(propan-2-yl)phenyl]-N'-(2-pyridin-2-ylethyl)benzenecarboximidamide |
| SMILES | CC(C)c1cccc(C(C)C)c1N/C(=N/CCc1ccccn1)c1ccccc1 |
| InChI | InChI=1S/C26H31N3/c1-19(2)23-14-10-15-24(20(3)4)25(23)29-26(21-11-6-5-7-12-21)28-18-16-22-13-8-9-17-27-22/h5-15,17,19-20H,16,18H2,1-4H3,(H,28,29) |
| InChIKey | ZWOJRIGPTQQVKN-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 37.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.56 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|