C34H40N6 — CID 101116594
1-N',2-N'-bis(2-pyridin-2-ylethyl)-1-N,2-N-bis(2,4,6-trimethylphenyl)ethanediimidamide (PubChem CID 101116594) has the molecular formula C34H40N6 and a molecular weight of 532.74 g/mol. Its IUPAC name is 1-N',2-N'-bis(2-pyridin-2-ylethyl)-1-N,2-N-bis(2,4,6-trimethylphenyl)ethanediimidamide.
| Compound Name | 1-N',2-N'-bis(2-pyridin-2-ylethyl)-1-N,2-N-bis(2,4,6-trimethylphenyl)ethanediimidamide |
|---|---|
| PubChem CID | 101116594 |
| Molecular Formula | C34H40N6 |
| Molecular Weight | 532.74 g/mol |
| Exact Mass | 532.33 |
| IUPAC Name | 1-N',2-N'-bis(2-pyridin-2-ylethyl)-1-N,2-N-bis(2,4,6-trimethylphenyl)ethanediimidamide |
| SMILES | Cc1cc(C)c(NC(=N/CCc2ccccn2)/C(=N\CCc2ccccn2)Nc2c(C)cc(C)cc2C)c(C)c1 |
| InChI | InChI=1S/C34H40N6/c1-23-19-25(3)31(26(4)20-23)39-33(37-17-13-29-11-7-9-15-35-29)34(38-18-14-30-12-8-10-16-36-30)40-32-27(5)21-24(2)22-28(32)6/h7-12,15-16,19-22H,13-14,17-18H2,1-6H3,(H,37,39)(H,38,40) |
| InChIKey | BUIKHKVUEOVHMJ-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 74.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.74 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|