C15H22N6 — CID 161239172
2-pyridin-2-ylethanamine;2-(2-pyridin-2-ylethyl)guanidine (PubChem CID 161239172) has the molecular formula C15H22N6 and a molecular weight of 286.38 g/mol. Its IUPAC name is 2-pyridin-2-ylethanamine;2-(2-pyridin-2-ylethyl)guanidine.
| Compound Name | 2-pyridin-2-ylethanamine;2-(2-pyridin-2-ylethyl)guanidine |
|---|---|
| PubChem CID | 161239172 |
| Molecular Formula | C15H22N6 |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.19 |
| IUPAC Name | 2-pyridin-2-ylethanamine;2-(2-pyridin-2-ylethyl)guanidine |
| SMILES | NC(N)=NCCc1ccccn1.NCCc1ccccn1 |
| InChI | InChI=1S/C8H12N4.C7H10N2/c9-8(10)12-6-4-7-3-1-2-5-11-7;8-5-4-7-3-1-2-6-9-7/h1-3,5H,4,6H2,(H4,9,10,12);1-3,6H,4-5,8H2 |
| InChIKey | UZTQWIGRSZYWCN-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|