C10H15N3S — CID 14126562
methyl N'-(3-pyridin-2-ylpropyl)carbamimidothioate (PubChem CID 14126562) has the molecular formula C10H15N3S and a molecular weight of 209.32 g/mol. Its IUPAC name is methyl N'-(3-pyridin-2-ylpropyl)carbamimidothioate.
| Compound Name | methyl N'-(3-pyridin-2-ylpropyl)carbamimidothioate |
|---|---|
| PubChem CID | 14126562 |
| Molecular Formula | C10H15N3S |
| Molecular Weight | 209.32 g/mol |
| Exact Mass | 209.10 |
| IUPAC Name | methyl N'-(3-pyridin-2-ylpropyl)carbamimidothioate |
| SMILES | CS/C(N)=N\CCCc1ccccn1 |
| InChI | InChI=1S/C10H15N3S/c1-14-10(11)13-8-4-6-9-5-2-3-7-12-9/h2-3,5,7H,4,6,8H2,1H3,(H2,11,13) |
| InChIKey | YSBJIFFZKMXIFN-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 51.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.32 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|