C12H21IN4 — CID 111024703
1,1,3,3-tetramethyl-2-(2-pyridin-2-ylethyl)guanidine;hydroiodide (PubChem CID 111024703) has the molecular formula C12H21IN4 and a molecular weight of 348.23 g/mol. Its IUPAC name is 1,1,3,3-tetramethyl-2-(2-pyridin-2-ylethyl)guanidine;hydroiodide.
| Compound Name | 1,1,3,3-tetramethyl-2-(2-pyridin-2-ylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111024703 |
| Molecular Formula | C12H21IN4 |
| Molecular Weight | 348.23 g/mol |
| Exact Mass | 348.08 |
| IUPAC Name | 1,1,3,3-tetramethyl-2-(2-pyridin-2-ylethyl)guanidine;hydroiodide |
| SMILES | CN(C)C(=NCCc1ccccn1)N(C)C.I |
| InChI | InChI=1S/C12H20N4.HI/c1-15(2)12(16(3)4)14-10-8-11-7-5-6-9-13-11;/h5-7,9H,8,10H2,1-4H3;1H |
| InChIKey | YQIKAUOVNBTWNH-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 31.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.23 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|