C18H24BrIN4 — CID 111292778
1-[(4-bromophenyl)methyl]-3-ethyl-1-methyl-2-(2-pyridin-2-ylethyl)guanidine;hydroiodide (PubChem CID 111292778) has the molecular formula C18H24BrIN4 and a molecular weight of 503.23 g/mol. Its IUPAC name is 1-[(4-bromophenyl)methyl]-3-ethyl-1-methyl-2-(2-pyridin-2-ylethyl)guanidine;hydroiodide.
| Compound Name | 1-[(4-bromophenyl)methyl]-3-ethyl-1-methyl-2-(2-pyridin-2-ylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111292778 |
| Molecular Formula | C18H24BrIN4 |
| Molecular Weight | 503.23 g/mol |
| Exact Mass | 502.02 |
| IUPAC Name | 1-[(4-bromophenyl)methyl]-3-ethyl-1-methyl-2-(2-pyridin-2-ylethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCc1ccccn1)N(C)Cc1ccc(Br)cc1.I |
| InChI | InChI=1S/C18H23BrN4.HI/c1-3-20-18(22-13-11-17-6-4-5-12-21-17)23(2)14-15-7-9-16(19)10-8-15;/h4-10,12H,3,11,13-14H2,1-2H3,(H,20,22);1H |
| InChIKey | GBPDPVIGVMJATB-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 40.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.23 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|