C15H24BrN3O — CID 111293203
1-[(4-bromophenyl)methyl]-2-(2-ethoxyethyl)-3-ethyl-1-methylguanidine (PubChem CID 111293203) has the molecular formula C15H24BrN3O and a molecular weight of 342.28 g/mol. Its IUPAC name is 1-[(4-bromophenyl)methyl]-2-(2-ethoxyethyl)-3-ethyl-1-methylguanidine.
| Compound Name | 1-[(4-bromophenyl)methyl]-2-(2-ethoxyethyl)-3-ethyl-1-methylguanidine |
|---|---|
| PubChem CID | 111293203 |
| Molecular Formula | C15H24BrN3O |
| Molecular Weight | 342.28 g/mol |
| Exact Mass | 341.11 |
| IUPAC Name | 1-[(4-bromophenyl)methyl]-2-(2-ethoxyethyl)-3-ethyl-1-methylguanidine |
| SMILES | CCN/C(=N\CCOCC)N(C)Cc1ccc(Br)cc1 |
| InChI | InChI=1S/C15H24BrN3O/c1-4-17-15(18-10-11-20-5-2)19(3)12-13-6-8-14(16)9-7-13/h6-9H,4-5,10-12H2,1-3H3,(H,17,18) |
| InChIKey | WGYOVMMXCXDVSW-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.28 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|