C17H29BrIN3O — CID 111275822
1-[(2-bromophenyl)methyl]-2-(4-ethoxybutyl)-3-ethyl-1-methylguanidine;hydroiodide (PubChem CID 111275822) has the molecular formula C17H29BrIN3O and a molecular weight of 498.25 g/mol. Its IUPAC name is 1-[(2-bromophenyl)methyl]-2-(4-ethoxybutyl)-3-ethyl-1-methylguanidine;hydroiodide.
| Compound Name | 1-[(2-bromophenyl)methyl]-2-(4-ethoxybutyl)-3-ethyl-1-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111275822 |
| Molecular Formula | C17H29BrIN3O |
| Molecular Weight | 498.25 g/mol |
| Exact Mass | 497.05 |
| IUPAC Name | 1-[(2-bromophenyl)methyl]-2-(4-ethoxybutyl)-3-ethyl-1-methylguanidine;hydroiodide |
| SMILES | CCN/C(=N\CCCCOCC)N(C)Cc1ccccc1Br.I |
| InChI | InChI=1S/C17H28BrN3O.HI/c1-4-19-17(20-12-8-9-13-22-5-2)21(3)14-15-10-6-7-11-16(15)18;/h6-7,10-11H,4-5,8-9,12-14H2,1-3H3,(H,19,20);1H |
| InChIKey | SSJGNVJNMOMNMS-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.25 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|