C17H29BrN4O2S — CID 111276057
1-[(2-bromophenyl)methyl]-3-ethyl-2-[3-[ethylsulfonyl(methyl)amino]propyl]-1-methylguanidine (PubChem CID 111276057) has the molecular formula C17H29BrN4O2S and a molecular weight of 433.42 g/mol. Its IUPAC name is 1-[(2-bromophenyl)methyl]-3-ethyl-2-[3-[ethylsulfonyl(methyl)amino]propyl]-1-methylguanidine.
| Compound Name | 1-[(2-bromophenyl)methyl]-3-ethyl-2-[3-[ethylsulfonyl(methyl)amino]propyl]-1-methylguanidine |
|---|---|
| PubChem CID | 111276057 |
| Molecular Formula | C17H29BrN4O2S |
| Molecular Weight | 433.42 g/mol |
| Exact Mass | 432.12 |
| IUPAC Name | 1-[(2-bromophenyl)methyl]-3-ethyl-2-[3-[ethylsulfonyl(methyl)amino]propyl]-1-methylguanidine |
| SMILES | CCN/C(=N\CCCN(C)S(=O)(=O)CC)N(C)Cc1ccccc1Br |
| InChI | InChI=1S/C17H29BrN4O2S/c1-5-19-17(20-12-9-13-22(4)25(23,24)6-2)21(3)14-15-10-7-8-11-16(15)18/h7-8,10-11H,5-6,9,12-14H2,1-4H3,(H,19,20) |
| InChIKey | HRGFDZQUYGOWCG-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 65.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.42 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|