C18H27BrN4O — CID 111276199
1-[(2-bromophenyl)methyl]-3-ethyl-1-methyl-2-(3-oxo-3-pyrrolidin-1-ylpropyl)guanidine (PubChem CID 111276199) has the molecular formula C18H27BrN4O and a molecular weight of 395.35 g/mol. Its IUPAC name is 1-[(2-bromophenyl)methyl]-3-ethyl-1-methyl-2-(3-oxo-3-pyrrolidin-1-ylpropyl)guanidine.
| Compound Name | 1-[(2-bromophenyl)methyl]-3-ethyl-1-methyl-2-(3-oxo-3-pyrrolidin-1-ylpropyl)guanidine |
|---|---|
| PubChem CID | 111276199 |
| Molecular Formula | C18H27BrN4O |
| Molecular Weight | 395.35 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | 1-[(2-bromophenyl)methyl]-3-ethyl-1-methyl-2-(3-oxo-3-pyrrolidin-1-ylpropyl)guanidine |
| SMILES | CCN/C(=N\CCC(=O)N1CCCC1)N(C)Cc1ccccc1Br |
| InChI | InChI=1S/C18H27BrN4O/c1-3-20-18(21-11-10-17(24)23-12-6-7-13-23)22(2)14-15-8-4-5-9-16(15)19/h4-5,8-9H,3,6-7,10-14H2,1-2H3,(H,20,21) |
| InChIKey | CXPQLMAFJDVSJD-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 47.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.35 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|