C15H24BrIN4O — CID 111276358
2-[[[(2-bromophenyl)methyl-methylamino]-(ethylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide (PubChem CID 111276358) has the molecular formula C15H24BrIN4O and a molecular weight of 483.19 g/mol. Its IUPAC name is 2-[[[(2-bromophenyl)methyl-methylamino]-(ethylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide.
| Compound Name | 2-[[[(2-bromophenyl)methyl-methylamino]-(ethylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
|---|---|
| PubChem CID | 111276358 |
| Molecular Formula | C15H24BrIN4O |
| Molecular Weight | 483.19 g/mol |
| Exact Mass | 482.02 |
| IUPAC Name | 2-[[[(2-bromophenyl)methyl-methylamino]-(ethylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
| SMILES | CCN/C(=N\CC(=O)N(C)C)N(C)Cc1ccccc1Br.I |
| InChI | InChI=1S/C15H23BrN4O.HI/c1-5-17-15(18-10-14(21)19(2)3)20(4)11-12-8-6-7-9-13(12)16;/h6-9H,5,10-11H2,1-4H3,(H,17,18);1H |
| InChIKey | FBLAVYUVUYRENA-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 47.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.19 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|