C25H30NP — CID 139101300
2-pyridin-2-ylethyl-bis(2,4,6-trimethylphenyl)phosphane (PubChem CID 139101300) has the molecular formula C25H30NP and a molecular weight of 375.50 g/mol. Its IUPAC name is 2-pyridin-2-ylethyl-bis(2,4,6-trimethylphenyl)phosphane.
| Compound Name | 2-pyridin-2-ylethyl-bis(2,4,6-trimethylphenyl)phosphane |
|---|---|
| PubChem CID | 139101300 |
| Molecular Formula | C25H30NP |
| Molecular Weight | 375.50 g/mol |
| Exact Mass | 375.21 |
| IUPAC Name | 2-pyridin-2-ylethyl-bis(2,4,6-trimethylphenyl)phosphane |
| SMILES | Cc1cc(C)c(P(CCc2ccccn2)c2c(C)cc(C)cc2C)c(C)c1 |
| InChI | InChI=1S/C25H30NP/c1-17-13-19(3)24(20(4)14-17)27(12-10-23-9-7-8-11-26-23)25-21(5)15-18(2)16-22(25)6/h7-9,11,13-16H,10,12H2,1-6H3 |
| InChIKey | PVZCELRDLJWSNA-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.50 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|