C19H24IN3O — CID 139099427
2-[2-[3-(2,4,6-trimethylphenyl)imidazol-1-ium-1-yl]ethyl]pyridine;iodide;hydrate (PubChem CID 139099427) has the molecular formula C19H24IN3O and a molecular weight of 437.33 g/mol. Its IUPAC name is 2-[2-[3-(2,4,6-trimethylphenyl)imidazol-1-ium-1-yl]ethyl]pyridine;iodide;hydrate.
| Compound Name | 2-[2-[3-(2,4,6-trimethylphenyl)imidazol-1-ium-1-yl]ethyl]pyridine;iodide;hydrate |
|---|---|
| PubChem CID | 139099427 |
| Molecular Formula | C19H24IN3O |
| Molecular Weight | 437.33 g/mol |
| Exact Mass | 437.10 |
| IUPAC Name | 2-[2-[3-(2,4,6-trimethylphenyl)imidazol-1-ium-1-yl]ethyl]pyridine;iodide;hydrate |
| SMILES | Cc1cc(C)c(-n2cc[n+](CCc3ccccn3)c2)c(C)c1.O.[I-] |
| InChI | InChI=1S/C19H22N3.HI.H2O/c1-15-12-16(2)19(17(3)13-15)22-11-10-21(14-22)9-7-18-6-4-5-8-20-18;;/h4-6,8,10-14H,7,9H2,1-3H3;1H;1H2/q+1;;/p-1 |
| InChIKey | PNUUOYRPHOESIC-UHFFFAOYSA-M |
| XLogP | -0.49 |
| TPSA | 53.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.33 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|