C12H15N2O4P — CID 24844771
dihydrogen phosphate;2-(2-pyridin-1-ium-1-ylethyl)pyridine (PubChem CID 24844771) has the molecular formula C12H15N2O4P and a molecular weight of 282.24 g/mol. Its IUPAC name is dihydrogen phosphate;2-(2-pyridin-1-ium-1-ylethyl)pyridine.
| Compound Name | dihydrogen phosphate;2-(2-pyridin-1-ium-1-ylethyl)pyridine |
|---|---|
| PubChem CID | 24844771 |
| Molecular Formula | C12H15N2O4P |
| Molecular Weight | 282.24 g/mol |
| Exact Mass | 282.08 |
| IUPAC Name | dihydrogen phosphate;2-(2-pyridin-1-ium-1-ylethyl)pyridine |
| SMILES | O=P([O-])(O)O.c1cc[n+](CCc2ccccn2)cc1 |
| InChI | InChI=1S/C12H13N2.H3O4P/c1-4-9-14(10-5-1)11-7-12-6-2-3-8-13-12;1-5(2,3)4/h1-6,8-10H,7,11H2;(H3,1,2,3,4)/q+1;/p-1 |
| InChIKey | WMOUKXZVZALMKS-UHFFFAOYSA-M |
| XLogP | 0.05 |
| TPSA | 97.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.24 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|