C9H16N2O6P2 — CID 15290103
[phosphonomethyl(2-pyridin-2-ylethyl)amino]methylphosphonic acid (PubChem CID 15290103) has the molecular formula C9H16N2O6P2 and a molecular weight of 310.18 g/mol. Its IUPAC name is [phosphonomethyl(2-pyridin-2-ylethyl)amino]methylphosphonic acid.
| Compound Name | [phosphonomethyl(2-pyridin-2-ylethyl)amino]methylphosphonic acid |
|---|---|
| PubChem CID | 15290103 |
| Molecular Formula | C9H16N2O6P2 |
| Molecular Weight | 310.18 g/mol |
| Exact Mass | 310.05 |
| IUPAC Name | [phosphonomethyl(2-pyridin-2-ylethyl)amino]methylphosphonic acid |
| SMILES | O=P(O)(O)CN(CCc1ccccn1)CP(=O)(O)O |
| InChI | InChI=1S/C9H16N2O6P2/c12-18(13,14)7-11(8-19(15,16)17)6-4-9-3-1-2-5-10-9/h1-3,5H,4,6-8H2,(H2,12,13,14)(H2,15,16,17) |
| InChIKey | OLVJNYXCGDNQHZ-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 131.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.18 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|