C14H18N3O4P2+ — CID 139178486
[[bis(pyridin-2-ylmethyl)amino]methyl-hydroxyphosphoryl]methyl-hydroxy-oxophosphanium (PubChem CID 139178486) has the molecular formula C14H18N3O4P2+ and a molecular weight of 354.26 g/mol. Its IUPAC name is [[bis(pyridin-2-ylmethyl)amino]methyl-hydroxyphosphoryl]methyl-hydroxy-oxophosphanium.
| Compound Name | [[bis(pyridin-2-ylmethyl)amino]methyl-hydroxyphosphoryl]methyl-hydroxy-oxophosphanium |
|---|---|
| PubChem CID | 139178486 |
| Molecular Formula | C14H18N3O4P2+ |
| Molecular Weight | 354.26 g/mol |
| Exact Mass | 354.08 |
| IUPAC Name | [[bis(pyridin-2-ylmethyl)amino]methyl-hydroxyphosphoryl]methyl-hydroxy-oxophosphanium |
| SMILES | O=[P+](O)CP(=O)(O)CN(Cc1ccccn1)Cc1ccccn1 |
| InChI | InChI=1S/C14H17N3O4P2/c18-22(19)12-23(20,21)11-17(9-13-5-1-3-7-15-13)10-14-6-2-4-8-16-14/h1-8H,9-12H2,(H-,18,19,20,21)/p+1 |
| InChIKey | ABAHSOXUMGMVJQ-UHFFFAOYSA-O |
| XLogP | 2.40 |
| TPSA | 103.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.26 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|