C13H14N6 — CID 130353298
N-(azidomethyl)-1-pyridin-2-yl-N-(pyridin-2-ylmethyl)methanamine (PubChem CID 130353298) has the molecular formula C13H14N6 and a molecular weight of 254.30 g/mol. Its IUPAC name is N-(azidomethyl)-1-pyridin-2-yl-N-(pyridin-2-ylmethyl)methanamine.
| Compound Name | N-(azidomethyl)-1-pyridin-2-yl-N-(pyridin-2-ylmethyl)methanamine |
|---|---|
| PubChem CID | 130353298 |
| Molecular Formula | C13H14N6 |
| Molecular Weight | 254.30 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | N-(azidomethyl)-1-pyridin-2-yl-N-(pyridin-2-ylmethyl)methanamine |
| SMILES | [N-]=[N+]=NCN(Cc1ccccn1)Cc1ccccn1 |
| InChI | InChI=1S/C13H14N6/c14-18-17-11-19(9-12-5-1-3-7-15-12)10-13-6-2-4-8-16-13/h1-8H,9-11H2 |
| InChIKey | HOEJXVQCYXCCGC-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 77.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.30 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|