C19H19N7 — CID 134274845
1-[5-(azidomethyl)-2-pyridinyl]-N,N-bis(pyridin-2-ylmethyl)methanamine (PubChem CID 134274845) has the molecular formula C19H19N7 and a molecular weight of 345.41 g/mol. Its IUPAC name is 1-[5-(azidomethyl)-2-pyridinyl]-N,N-bis(pyridin-2-ylmethyl)methanamine.
| Compound Name | 1-[5-(azidomethyl)-2-pyridinyl]-N,N-bis(pyridin-2-ylmethyl)methanamine |
|---|---|
| PubChem CID | 134274845 |
| Molecular Formula | C19H19N7 |
| Molecular Weight | 345.41 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | 1-[5-(azidomethyl)-2-pyridinyl]-N,N-bis(pyridin-2-ylmethyl)methanamine |
| SMILES | [N-]=[N+]=NCc1ccc(CN(Cc2ccccn2)Cc2ccccn2)nc1 |
| InChI | InChI=1S/C19H19N7/c20-25-24-12-16-7-8-19(23-11-16)15-26(13-17-5-1-3-9-21-17)14-18-6-2-4-10-22-18/h1-11H,12-15H2 |
| InChIKey | HRLSAULDHBHKMM-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 90.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.41 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|