C13H22N2O2P+ — CID 4217393
piperidin-1-ium-1-ylmethyl(2-pyridin-2-ylethyl)phosphinic acid (PubChem CID 4217393) has the molecular formula C13H22N2O2P+ and a molecular weight of 269.30 g/mol. Its IUPAC name is piperidin-1-ium-1-ylmethyl(2-pyridin-2-ylethyl)phosphinic acid.
| Compound Name | piperidin-1-ium-1-ylmethyl(2-pyridin-2-ylethyl)phosphinic acid |
|---|---|
| PubChem CID | 4217393 |
| Molecular Formula | C13H22N2O2P+ |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | piperidin-1-ium-1-ylmethyl(2-pyridin-2-ylethyl)phosphinic acid |
| SMILES | O=P(O)(CCc1ccccn1)C[NH+]1CCCCC1 |
| InChI | InChI=1S/C13H21N2O2P/c16-18(17,12-15-9-4-1-5-10-15)11-7-13-6-2-3-8-14-13/h2-3,6,8H,1,4-5,7,9-12H2,(H,16,17)/p+1 |
| InChIKey | DXMGXSLERYJGTB-UHFFFAOYSA-O |
| XLogP | 0.92 |
| TPSA | 54.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|