C13H24N2O7P2 — CID 19776440
[1-hydroxy-3-[methyl(4-pyridin-2-ylbutyl)amino]-1-phosphonopropyl]phosphonic acid (PubChem CID 19776440) has the molecular formula C13H24N2O7P2 and a molecular weight of 382.29 g/mol. Its IUPAC name is [1-hydroxy-3-[methyl(4-pyridin-2-ylbutyl)amino]-1-phosphonopropyl]phosphonic acid.
| Compound Name | [1-hydroxy-3-[methyl(4-pyridin-2-ylbutyl)amino]-1-phosphonopropyl]phosphonic acid |
|---|---|
| PubChem CID | 19776440 |
| Molecular Formula | C13H24N2O7P2 |
| Molecular Weight | 382.29 g/mol |
| Exact Mass | 382.11 |
| IUPAC Name | [1-hydroxy-3-[methyl(4-pyridin-2-ylbutyl)amino]-1-phosphonopropyl]phosphonic acid |
| SMILES | CN(CCCCc1ccccn1)CCC(O)(P(=O)(O)O)P(=O)(O)O |
| InChI | InChI=1S/C13H24N2O7P2/c1-15(10-5-3-7-12-6-2-4-9-14-12)11-8-13(16,23(17,18)19)24(20,21)22/h2,4,6,9,16H,3,5,7-8,10-11H2,1H3,(H2,17,18,19)(H2,20,21,22) |
| InChIKey | DPDCUQPAXRVOGZ-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 151.42 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.29 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|