C11H20N2O7P2 — CID 18542139
[1-hydroxy-1-phosphono-3-(3-pyridin-2-ylpropylamino)propyl]phosphonic acid (PubChem CID 18542139) has the molecular formula C11H20N2O7P2 and a molecular weight of 354.24 g/mol. Its IUPAC name is [1-hydroxy-1-phosphono-3-(3-pyridin-2-ylpropylamino)propyl]phosphonic acid.
| Compound Name | [1-hydroxy-1-phosphono-3-(3-pyridin-2-ylpropylamino)propyl]phosphonic acid |
|---|---|
| PubChem CID | 18542139 |
| Molecular Formula | C11H20N2O7P2 |
| Molecular Weight | 354.24 g/mol |
| Exact Mass | 354.07 |
| IUPAC Name | [1-hydroxy-1-phosphono-3-(3-pyridin-2-ylpropylamino)propyl]phosphonic acid |
| SMILES | O=P(O)(O)C(O)(CCNCCCc1ccccn1)P(=O)(O)O |
| InChI | InChI=1S/C11H20N2O7P2/c14-11(21(15,16)17,22(18,19)20)6-9-12-7-3-5-10-4-1-2-8-13-10/h1-2,4,8,12,14H,3,5-7,9H2,(H2,15,16,17)(H2,18,19,20) |
| InChIKey | OTFOAOUZONDKBR-UHFFFAOYSA-N |
| XLogP | -0.00 |
| TPSA | 160.21 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.24 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|