C16H24N2O7P2 — CID 57022628
[1-hydroxy-3-methyl-1-phosphono-6-pyridin-2-yl-3-(1H-pyrrol-2-yl)hexyl]phosphonic acid (PubChem CID 57022628) has the molecular formula C16H24N2O7P2 and a molecular weight of 418.32 g/mol. Its IUPAC name is [1-hydroxy-3-methyl-1-phosphono-6-pyridin-2-yl-3-(1H-pyrrol-2-yl)hexyl]phosphonic acid.
| Compound Name | [1-hydroxy-3-methyl-1-phosphono-6-pyridin-2-yl-3-(1H-pyrrol-2-yl)hexyl]phosphonic acid |
|---|---|
| PubChem CID | 57022628 |
| Molecular Formula | C16H24N2O7P2 |
| Molecular Weight | 418.32 g/mol |
| Exact Mass | 418.11 |
| IUPAC Name | [1-hydroxy-3-methyl-1-phosphono-6-pyridin-2-yl-3-(1H-pyrrol-2-yl)hexyl]phosphonic acid |
| SMILES | CC(CCCc1ccccn1)(CC(O)(P(=O)(O)O)P(=O)(O)O)c1ccc[nH]1 |
| InChI | InChI=1S/C16H24N2O7P2/c1-15(14-8-5-11-18-14,9-4-7-13-6-2-3-10-17-13)12-16(19,26(20,21)22)27(23,24)25/h2-3,5-6,8,10-11,18-19H,4,7,9,12H2,1H3,(H2,20,21,22)(H2,23,24,25) |
| InChIKey | FDDHIBPSMVXHHL-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 163.97 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.32 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|