C14H17N2O3P — CID 130417323
N-methyl-N-phenyl-(2-pyridin-2-ylethoxy)phosphonamidic acid (PubChem CID 130417323) has the molecular formula C14H17N2O3P and a molecular weight of 292.28 g/mol. Its IUPAC name is N-methyl-N-phenyl-(2-pyridin-2-ylethoxy)phosphonamidic acid.
| Compound Name | N-methyl-N-phenyl-(2-pyridin-2-ylethoxy)phosphonamidic acid |
|---|---|
| PubChem CID | 130417323 |
| Molecular Formula | C14H17N2O3P |
| Molecular Weight | 292.28 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | N-methyl-N-phenyl-(2-pyridin-2-ylethoxy)phosphonamidic acid |
| SMILES | CN(c1ccccc1)P(=O)(O)OCCc1ccccn1 |
| InChI | InChI=1S/C14H17N2O3P/c1-16(14-8-3-2-4-9-14)20(17,18)19-12-10-13-7-5-6-11-15-13/h2-9,11H,10,12H2,1H3,(H,17,18) |
| InChIKey | SYUIGTCNBPZRPB-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.28 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|